About 3-methylundecanenitrile
3-methylundecanenitrile (PubChem CID 10702552) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 3-methylundecanenitrile.
Molecular Properties
| Compound Name | 3-methylundecanenitrile |
| PubChem CID | 10702552 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 3-methylundecanenitrile |
| SMILES | CCCCCCCCC(C)CC#N |
| InChI | InChI=1S/C12H23N/c1-3-4-5-6-7-8-9-12(2)10-11-13/h12H,3-10H2,1-2H3 |
| InChIKey | YBGLYNKRMUZVLM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylundecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylundecanenitrile?
The IUPAC name of 3-methylundecanenitrile (CID 10702552) is 3-methylundecanenitrile.
What is the SMILES notation for 3-methylundecanenitrile?
The canonical SMILES for 3-methylundecanenitrile is CCCCCCCCC(C)CC#N.
What is the InChIKey of 3-methylundecanenitrile?
The InChIKey is YBGLYNKRMUZVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-3-4-5-6-7-8-9-12(2)10-11-13/h12H,3-10H2,1-2H3.
What are the key properties of 3-methylundecanenitrile?
3-methylundecanenitrile has a molecular weight of 181.32 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylundecanenitrile is sourced from PubChem (CID 10702552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).