C10H12FNO2S — CID 107025881
N-(4-fluoro-2-methoxyphenyl)-3-sulfanylpropanamide (PubChem CID 107025881) has the molecular formula C10H12FNO2S and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-3-sulfanylpropanamide.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107025881 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-3-sulfanylpropanamide |
| SMILES | COc1cc(F)ccc1NC(=O)CCS |
| InChI | InChI=1S/C10H12FNO2S/c1-14-9-6-7(11)2-3-8(9)12-10(13)4-5-15/h2-3,6,15H,4-5H2,1H3,(H,12,13) |
| InChIKey | LAMMWWUEIPYEDA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|