C10H16O3 — CID 10702630
ethyl (2R,6S)-4,6-dimethyl-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 10702630) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is ethyl (2R,6S)-4,6-dimethyl-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | ethyl (2R,6S)-4,6-dimethyl-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 10702630 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | ethyl (2R,6S)-4,6-dimethyl-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(C)=C[C@H](C)O1 |
| InChI | InChI=1S/C10H16O3/c1-4-12-10(11)9-6-7(2)5-8(3)13-9/h5,8-9H,4,6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | QULHYENBSLHHNY-DTWKUNHWSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|