C10H16F3NOS — CID 107026726
N-cyclopropyl-3-methyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 107026726) has the molecular formula C10H16F3NOS and a molecular weight of 255.30 g/mol. Its IUPAC name is N-cyclopropyl-3-methyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | N-cyclopropyl-3-methyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 107026726 |
| Molecular Formula | C10H16F3NOS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-cyclopropyl-3-methyl-2-sulfanyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(C)C(S)C(=O)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H16F3NOS/c1-6(2)8(16)9(15)14(7-3-4-7)5-10(11,12)13/h6-8,16H,3-5H2,1-2H3 |
| InChIKey | VRALLWIUPKNLDB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|