C9H17NO3 — CID 10702741
[(3aR,4R,6aS)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol (PubChem CID 10702741) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol.
| Compound Name | [(3aR,4R,6aS)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol |
|---|---|
| PubChem CID | 10702741 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | [(3aR,4R,6aS)-2,2,5-trimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methanol |
| SMILES | CN1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C9H17NO3/c1-9(2)12-7-4-10(3)6(5-11)8(7)13-9/h6-8,11H,4-5H2,1-3H3/t6-,7+,8-/m1/s1 |
| InChIKey | SPIBUWQVCMAOIF-GJMOJQLCSA-N |
| XLogP | -0.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |