C12H12FN3OS — CID 107027466
2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]-5-sulfanylbenzamide (PubChem CID 107027466) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]-5-sulfanylbenzamide.
| Compound Name | 2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107027466 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]-5-sulfanylbenzamide |
| SMILES | Cn1cc(CNC(=O)c2cc(S)ccc2F)cn1 |
| InChI | InChI=1S/C12H12FN3OS/c1-16-7-8(6-15-16)5-14-12(17)10-4-9(18)2-3-11(10)13/h2-4,6-7,18H,5H2,1H3,(H,14,17) |
| InChIKey | TWYMGRUBUHEXLM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|