C12H17NOS — CID 107027681
N-(3,5-dimethylphenyl)-N-methyl-2-sulfanylpropanamide (PubChem CID 107027681) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-methyl-2-sulfanylpropanamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-methyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107027681 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-methyl-2-sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)C(C)S)c1 |
| InChI | InChI=1S/C12H17NOS/c1-8-5-9(2)7-11(6-8)13(4)12(14)10(3)15/h5-7,10,15H,1-4H3 |
| InChIKey | LNMWFWVSLMCSSN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|