C12H16N2OS — CID 107027847
(3-aminopyrrolidin-1-yl)-(2-methyl-5-sulfanylphenyl)methanone (PubChem CID 107027847) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(2-methyl-5-sulfanylphenyl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(2-methyl-5-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107027847 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(2-methyl-5-sulfanylphenyl)methanone |
| SMILES | Cc1ccc(S)cc1C(=O)N1CCC(N)C1 |
| InChI | InChI=1S/C12H16N2OS/c1-8-2-3-10(16)6-11(8)12(15)14-5-4-9(13)7-14/h2-3,6,9,16H,4-5,7,13H2,1H3 |
| InChIKey | CMCHVWFZTOIJTD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|