C6H9N3O4 — CID 10702803
(2S)-3-(2-nitroimidazol-1-yl)(214C)propane-1,2-diol (PubChem CID 10702803) has the molecular formula C6H9N3O4 and a molecular weight of 189.15 g/mol. Its IUPAC name is (2S)-3-(2-nitroimidazol-1-yl)(214C)propane-1,2-diol.
| Compound Name | (2S)-3-(2-nitroimidazol-1-yl)(214C)propane-1,2-diol |
|---|---|
| PubChem CID | 10702803 |
| Molecular Formula | C6H9N3O4 |
| Molecular Weight | 189.15 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2S)-3-(2-nitroimidazol-1-yl)(214C)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1nccn1C[14C@H](O)CO |
| InChI | InChI=1S/C6H9N3O4/c10-4-5(11)3-8-2-1-7-6(8)9(12)13/h1-2,5,10-11H,3-4H2/t5-/m0/s1/i5+2 |
| InChIKey | NUGLIYXAARVRPQ-YDUYVQCESA-N |
| XLogP | -0.86 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.15 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|