C11H14N2O — CID 10702855
3-(4-methoxyphenyl)-1,4,5,6-tetrahydropyridazine (PubChem CID 10702855) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,4,5,6-tetrahydropyridazine.
| Compound Name | 3-(4-methoxyphenyl)-1,4,5,6-tetrahydropyridazine |
|---|---|
| PubChem CID | 10702855 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,4,5,6-tetrahydropyridazine |
| SMILES | COc1ccc(C2=NNCCC2)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-14-10-6-4-9(5-7-10)11-3-2-8-12-13-11/h4-7,12H,2-3,8H2,1H3 |
| InChIKey | IUQIBSUGVWFPTJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |