C11H12F3NOS — CID 107028778
2-sulfanyl-N-[[2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 107028778) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-sulfanyl-N-[[2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2-sulfanyl-N-[[2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 107028778 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-sulfanyl-N-[[2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(S)C(=O)NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NOS/c1-7(17)10(16)15-6-8-4-2-3-5-9(8)11(12,13)14/h2-5,7,17H,6H2,1H3,(H,15,16) |
| InChIKey | BURRBAWZSQKHLR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|