C12H16O2 — CID 10702906
(4R,8aS)-4,5,8a-trimethyl-4,6-dihydro-3H-isochromen-1-one (PubChem CID 10702906) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (4R,8aS)-4,5,8a-trimethyl-4,6-dihydro-3H-isochromen-1-one.
| Compound Name | (4R,8aS)-4,5,8a-trimethyl-4,6-dihydro-3H-isochromen-1-one |
|---|---|
| PubChem CID | 10702906 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (4R,8aS)-4,5,8a-trimethyl-4,6-dihydro-3H-isochromen-1-one |
| SMILES | CC1=C2[C@@H](C)COC(=O)[C@@]2(C)C=CC1 |
| InChI | InChI=1S/C12H16O2/c1-8-5-4-6-12(3)10(8)9(2)7-14-11(12)13/h4,6,9H,5,7H2,1-3H3/t9-,12-/m0/s1 |
| InChIKey | RBEVWAPMWORYAD-CABZTGNLSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|