C8H7N3O3 — CID 10702934
6-methoxy-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 10702934) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 6-methoxy-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6-methoxy-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 10702934 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 6-methoxy-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | COc1ccc2[nH]c(=O)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C8H7N3O3/c1-14-5-3-2-4-6(10-5)11-8(13)7(12)9-4/h2-3H,1H3,(H,9,12)(H,10,11,13) |
| InChIKey | KFZAIAVEVDRGCG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|