C15H21NOS — CID 107030073
N-[(1-methylcyclopentyl)methyl]-2-(4-sulfanylphenyl)acetamide (PubChem CID 107030073) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[(1-methylcyclopentyl)methyl]-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-[(1-methylcyclopentyl)methyl]-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107030073 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(1-methylcyclopentyl)methyl]-2-(4-sulfanylphenyl)acetamide |
| SMILES | CC1(CNC(=O)Cc2ccc(S)cc2)CCCC1 |
| InChI | InChI=1S/C15H21NOS/c1-15(8-2-3-9-15)11-16-14(17)10-12-4-6-13(18)7-5-12/h4-7,18H,2-3,8-11H2,1H3,(H,16,17) |
| InChIKey | NZHGFHWKZKZHPZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|