C11H18N2OS2 — CID 107030171
N,3-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2-sulfanylbutanamide (PubChem CID 107030171) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N,3-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2-sulfanylbutanamide.
| Compound Name | N,3-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107030171 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N,3-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-2-sulfanylbutanamide |
| SMILES | Cc1ncsc1CN(C)C(=O)C(S)C(C)C |
| InChI | InChI=1S/C11H18N2OS2/c1-7(2)10(15)11(14)13(4)5-9-8(3)12-6-16-9/h6-7,10,15H,5H2,1-4H3 |
| InChIKey | XWXBTZPMJLKXML-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|