C9H17NOS — CID 107030339
N-(1-cyclopropylpropan-2-yl)-2-sulfanylpropanamide (PubChem CID 107030339) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)-2-sulfanylpropanamide.
| Compound Name | N-(1-cyclopropylpropan-2-yl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107030339 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)-2-sulfanylpropanamide |
| SMILES | CC(CC1CC1)NC(=O)C(C)S |
| InChI | InChI=1S/C9H17NOS/c1-6(5-8-3-4-8)10-9(11)7(2)12/h6-8,12H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | OOWVZMMEGSVUPH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|