C9H8N2O3S2 — CID 107031711
4-(4-sulfanylthiophene-2-carbonyl)piperazine-2,6-dione (PubChem CID 107031711) has the molecular formula C9H8N2O3S2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-(4-sulfanylthiophene-2-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(4-sulfanylthiophene-2-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 107031711 |
| Molecular Formula | C9H8N2O3S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 4-(4-sulfanylthiophene-2-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2cc(S)cs2)CC(=O)N1 |
| InChI | InChI=1S/C9H8N2O3S2/c12-7-2-11(3-8(13)10-7)9(14)6-1-5(15)4-16-6/h1,4,15H,2-3H2,(H,10,12,13) |
| InChIKey | LKRIJYKMDQLCCP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|