C9H12O5 — CID 10703179
(4aS,5R,6R)-4a,5,6-trihydroxy-7-methyl-3,4,5,6-tetrahydrocyclopenta[c]pyran-1-one (PubChem CID 10703179) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (4aS,5R,6R)-4a,5,6-trihydroxy-7-methyl-3,4,5,6-tetrahydrocyclopenta[c]pyran-1-one.
| Compound Name | (4aS,5R,6R)-4a,5,6-trihydroxy-7-methyl-3,4,5,6-tetrahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 10703179 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4aS,5R,6R)-4a,5,6-trihydroxy-7-methyl-3,4,5,6-tetrahydrocyclopenta[c]pyran-1-one |
| SMILES | CC1=C2C(=O)OCC[C@@]2(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O5/c1-4-5-8(12)14-3-2-9(5,13)7(11)6(4)10/h6-7,10-11,13H,2-3H2,1H3/t6-,7-,9+/m1/s1 |
| InChIKey | FFVCONHJAWBWCX-BHNWBGBOSA-N |
| XLogP | -1.28 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |