C7H12N4O3 — CID 10703186
(4S,5R,6R,7R)-4-amino-7-(hydroxymethyl)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-5,6-diol (PubChem CID 10703186) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is (4S,5R,6R,7R)-4-amino-7-(hydroxymethyl)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-5,6-diol.
| Compound Name | (4S,5R,6R,7R)-4-amino-7-(hydroxymethyl)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-5,6-diol |
|---|---|
| PubChem CID | 10703186 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (4S,5R,6R,7R)-4-amino-7-(hydroxymethyl)-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-5,6-diol |
| SMILES | N[C@H]1c2cnnn2[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12N4O3/c8-5-3-1-9-10-11(3)4(2-12)6(13)7(5)14/h1,4-7,12-14H,2,8H2/t4-,5+,6-,7-/m1/s1 |
| InChIKey | SZDUYHOBUYTODU-XZBKPIIZSA-N |
| XLogP | -2.45 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |