About 3-butylquinolin-2-amine
3-butylquinolin-2-amine (PubChem CID 10703219) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-butylquinolin-2-amine.
Molecular Properties
| Compound Name | 3-butylquinolin-2-amine |
| PubChem CID | 10703219 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-butylquinolin-2-amine |
| SMILES | CCCCc1cc2ccccc2nc1N |
| InChI | InChI=1S/C13H16N2/c1-2-3-6-11-9-10-7-4-5-8-12(10)15-13(11)14/h4-5,7-9H,2-3,6H2,1H3,(H2,14,15) |
| InChIKey | IHTBKVYBYWJXII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylquinolin-2-amine?
The IUPAC name of 3-butylquinolin-2-amine (CID 10703219) is 3-butylquinolin-2-amine.
What is the SMILES notation for 3-butylquinolin-2-amine?
The canonical SMILES for 3-butylquinolin-2-amine is CCCCc1cc2ccccc2nc1N.
What is the InChIKey of 3-butylquinolin-2-amine?
The InChIKey is IHTBKVYBYWJXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-3-6-11-9-10-7-4-5-8-12(10)15-13(11)14/h4-5,7-9H,2-3,6H2,1H3,(H2,14,15).
What are the key properties of 3-butylquinolin-2-amine?
3-butylquinolin-2-amine has a molecular weight of 200.28 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylquinolin-2-amine is sourced from PubChem (CID 10703219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).