C16H22BrNOS — CID 107032458
2-bromo-N-cyclopentyl-N-(2-methylpropyl)-5-sulfanylbenzamide (PubChem CID 107032458) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-bromo-N-cyclopentyl-N-(2-methylpropyl)-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-cyclopentyl-N-(2-methylpropyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107032458 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-bromo-N-cyclopentyl-N-(2-methylpropyl)-5-sulfanylbenzamide |
| SMILES | CC(C)CN(C(=O)c1cc(S)ccc1Br)C1CCCC1 |
| InChI | InChI=1S/C16H22BrNOS/c1-11(2)10-18(12-5-3-4-6-12)16(19)14-9-13(20)7-8-15(14)17/h7-9,11-12,20H,3-6,10H2,1-2H3 |
| InChIKey | BTLYDTOWQSGNOU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|