C13H19NOS2 — CID 107034211
N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-sulfanylbenzamide (PubChem CID 107034211) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-sulfanylbenzamide.
| Compound Name | N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 107034211 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-sulfanylbenzamide |
| SMILES | CCC(CSC)N(C)C(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C13H19NOS2/c1-4-11(9-17-3)14(2)13(15)10-5-7-12(16)8-6-10/h5-8,11,16H,4,9H2,1-3H3 |
| InChIKey | DYXFKYZOHDOIEF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|