C12H18N2O — CID 10703493
2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]acetonitrile (PubChem CID 10703493) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]acetonitrile.
| Compound Name | 2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]acetonitrile |
|---|---|
| PubChem CID | 10703493 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-[[(1R,2R,5R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]acetonitrile |
| SMILES | CC1(C)[C@H]2C/C(=N\CC#N)[C@](C)(O)[C@@H]1C2 |
| InChI | InChI=1S/C12H18N2O/c1-11(2)8-6-9(11)12(3,15)10(7-8)14-5-4-13/h8-9,15H,5-7H2,1-3H3/b14-10+/t8-,9-,12-/m1/s1 |
| InChIKey | MUFHRPRAQSPURX-RDPNCVAISA-N |
| XLogP | 1.77 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|