C9H16N6 — CID 10703582
2-N,6,7-trimethyl-5,6,7,8-tetrahydropteridine-2,4-diamine (PubChem CID 10703582) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is 2-N,6,7-trimethyl-5,6,7,8-tetrahydropteridine-2,4-diamine.
| Compound Name | 2-N,6,7-trimethyl-5,6,7,8-tetrahydropteridine-2,4-diamine |
|---|---|
| PubChem CID | 10703582 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-N,6,7-trimethyl-5,6,7,8-tetrahydropteridine-2,4-diamine |
| SMILES | CNc1nc(N)c2c(n1)NC(C)C(C)N2 |
| InChI | InChI=1S/C9H16N6/c1-4-5(2)13-8-6(12-4)7(10)14-9(11-3)15-8/h4-5,12H,1-3H3,(H4,10,11,13,14,15) |
| InChIKey | UEMGELRGDQYAPX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |