C13H20O2 — CID 10703591
4-methyl-4-prop-2-enoxynona-1,8-dien-5-one (PubChem CID 10703591) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-methyl-4-prop-2-enoxynona-1,8-dien-5-one.
| Compound Name | 4-methyl-4-prop-2-enoxynona-1,8-dien-5-one |
|---|---|
| PubChem CID | 10703591 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-methyl-4-prop-2-enoxynona-1,8-dien-5-one |
| SMILES | C=CCCC(=O)C(C)(CC=C)OCC=C |
| InChI | InChI=1S/C13H20O2/c1-5-8-9-12(14)13(4,10-6-2)15-11-7-3/h5-7H,1-3,8-11H2,4H3 |
| InChIKey | MRBAWWOOXPSROW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|