C13H16FNO2S — CID 107036494
4-fluoro-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-sulfanylbenzamide (PubChem CID 107036494) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-fluoro-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-sulfanylbenzamide.
| Compound Name | 4-fluoro-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107036494 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-fluoro-N-[[1-(2-hydroxyethyl)cyclopropyl]methyl]-3-sulfanylbenzamide |
| SMILES | O=C(NCC1(CCO)CC1)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C13H16FNO2S/c14-10-2-1-9(7-11(10)18)12(17)15-8-13(3-4-13)5-6-16/h1-2,7,16,18H,3-6,8H2,(H,15,17) |
| InChIKey | DGHYIJPUYYGYAW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|