C14H19NO3S — CID 107036511
[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(2-sulfanylphenyl)methanone (PubChem CID 107036511) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(2-sulfanylphenyl)methanone.
| Compound Name | [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(2-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107036511 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]-(2-sulfanylphenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccccc2S)CC(CO)O1 |
| InChI | InChI=1S/C14H19NO3S/c1-14(2)9-15(7-10(8-16)18-14)13(17)11-5-3-4-6-12(11)19/h3-6,10,16,19H,7-9H2,1-2H3 |
| InChIKey | KDVUZBKKUCJVEZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|