C13H26Si — CID 10703692
deca-2,3-dien-4-yl(trimethyl)silane (PubChem CID 10703692) has the molecular formula C13H26Si and a molecular weight of 210.44 g/mol. Its IUPAC name is deca-2,3-dien-4-yl(trimethyl)silane.
| Compound Name | deca-2,3-dien-4-yl(trimethyl)silane |
|---|---|
| PubChem CID | 10703692 |
| Molecular Formula | C13H26Si |
| Molecular Weight | 210.44 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | deca-2,3-dien-4-yl(trimethyl)silane |
| SMILES | CC=C=C(CCCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C13H26Si/c1-6-8-9-10-12-13(11-7-2)14(3,4)5/h7H,6,8-10,12H2,1-5H3 |
| InChIKey | SRNBEFODRTUYLJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|