C10H10ClNO2 — CID 10703730
(1S,5S)-6-chloro-1,5-dimethyl-2-oxo-8-oxabicyclo[3.2.1]oct-3-ene-6-carbonitrile (PubChem CID 10703730) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (1S,5S)-6-chloro-1,5-dimethyl-2-oxo-8-oxabicyclo[3.2.1]oct-3-ene-6-carbonitrile.
| Compound Name | (1S,5S)-6-chloro-1,5-dimethyl-2-oxo-8-oxabicyclo[3.2.1]oct-3-ene-6-carbonitrile |
|---|---|
| PubChem CID | 10703730 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (1S,5S)-6-chloro-1,5-dimethyl-2-oxo-8-oxabicyclo[3.2.1]oct-3-ene-6-carbonitrile |
| SMILES | C[C@]12CC(Cl)(C#N)[C@](C)(C=CC1=O)O2 |
| InChI | InChI=1S/C10H10ClNO2/c1-8-5-10(11,6-12)9(2,14-8)4-3-7(8)13/h3-4H,5H2,1-2H3/t8-,9-,10?/m0/s1 |
| InChIKey | NZLPGPXFDGPSOP-XMCUXHSSSA-N |
| XLogP | 1.56 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|