C16H22N2O2 — CID 107037714
N-(isoquinolin-6-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 107037714) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(isoquinolin-6-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | N-(isoquinolin-6-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 107037714 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(isoquinolin-6-ylmethyl)-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNCc1ccc2cnccc2c1 |
| InChI | InChI=1S/C16H22N2O2/c1-19-9-10-20-8-2-6-17-12-14-3-4-16-13-18-7-5-15(16)11-14/h3-5,7,11,13,17H,2,6,8-10,12H2,1H3 |
| InChIKey | AIIOZGXTPBLWCI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|