C16H16N2O — CID 107038302
1-isoquinolin-6-yl-N-[(5-methylfuran-2-yl)methyl]methanamine (PubChem CID 107038302) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 1-isoquinolin-6-yl-N-[(5-methylfuran-2-yl)methyl]methanamine.
| Compound Name | 1-isoquinolin-6-yl-N-[(5-methylfuran-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 107038302 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-isoquinolin-6-yl-N-[(5-methylfuran-2-yl)methyl]methanamine |
| SMILES | Cc1ccc(CNCc2ccc3cnccc3c2)o1 |
| InChI | InChI=1S/C16H16N2O/c1-12-2-5-16(19-12)11-18-9-13-3-4-15-10-17-7-6-14(15)8-13/h2-8,10,18H,9,11H2,1H3 |
| InChIKey | ZAHAUWWFFKXUHL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |