C14H17NO — CID 10703894
(3R,5S,8aR)-5-methyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 10703894) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (3R,5S,8aR)-5-methyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3R,5S,8aR)-5-methyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 10703894 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (3R,5S,8aR)-5-methyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | C[C@H]1C=CC[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C14H17NO/c1-11-6-5-9-14-15(11)13(10-16-14)12-7-3-2-4-8-12/h2-8,11,13-14H,9-10H2,1H3/t11-,13-,14+/m0/s1 |
| InChIKey | XVLIBNDXZPITPC-FPMFFAJLSA-N |
| XLogP | 2.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|