C11H17NO3S — CID 107039684
methyl 3-[2-(propoxymethyl)-1,3-thiazol-4-yl]propanoate (PubChem CID 107039684) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is methyl 3-[2-(propoxymethyl)-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-(propoxymethyl)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107039684 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 3-[2-(propoxymethyl)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCCOCc1nc(CCC(=O)OC)cs1 |
| InChI | InChI=1S/C11H17NO3S/c1-3-6-15-7-10-12-9(8-16-10)4-5-11(13)14-2/h8H,3-7H2,1-2H3 |
| InChIKey | KNMHRYAVIDVTFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|