C14H19NO — CID 10703996
5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole (PubChem CID 10703996) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole.
| Compound Name | 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 10703996 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole |
| SMILES | CC1=CCCC(C)(C)C1/C=C/c1ccno1 |
| InChI | InChI=1S/C14H19NO/c1-11-5-4-9-14(2,3)13(11)7-6-12-8-10-15-16-12/h5-8,10,13H,4,9H2,1-3H3/b7-6+ |
| InChIKey | LBLSJVJDWYLRHN-VOTSOKGWSA-N |
| XLogP | 4.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|