C13H20N2O3S — CID 107040089
methyl 3-[2-(oxan-2-ylmethylamino)-1,3-thiazol-4-yl]propanoate (PubChem CID 107040089) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is methyl 3-[2-(oxan-2-ylmethylamino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-(oxan-2-ylmethylamino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107040089 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 3-[2-(oxan-2-ylmethylamino)-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(NCC2CCCCO2)n1 |
| InChI | InChI=1S/C13H20N2O3S/c1-17-12(16)6-5-10-9-19-13(15-10)14-8-11-4-2-3-7-18-11/h9,11H,2-8H2,1H3,(H,14,15) |
| InChIKey | POCNITCAPMEMDN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |