C15H23N3O2S — CID 107040506
methyl 3-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]propanoate (PubChem CID 107040506) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is methyl 3-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107040506 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 3-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C15H23N3O2S/c1-20-14(19)6-5-12-11-21-15(16-12)18-9-8-17-7-3-2-4-13(17)10-18/h11,13H,2-10H2,1H3 |
| InChIKey | OIIOLXVFJSTNPG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |