About [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine
[4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine (PubChem CID 107040797) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine |
| PubChem CID | 107040797 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine |
| SMILES | Cn1cc(COC2(CN)CCC(C)(C)CC2)nn1 |
| InChI | InChI=1S/C13H24N4O/c1-12(2)4-6-13(10-14,7-5-12)18-9-11-8-17(3)16-15-11/h8H,4-7,9-10,14H2,1-3H3 |
| InChIKey | ZLIISPMUATZARM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine?
The IUPAC name of [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine (CID 107040797) is [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine.
What is the SMILES notation for [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine?
The canonical SMILES for [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine is Cn1cc(COC2(CN)CCC(C)(C)CC2)nn1.
What is the InChIKey of [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine?
The InChIKey is ZLIISPMUATZARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-12(2)4-6-13(10-14,7-5-12)18-9-11-8-17(3)16-15-11/h8H,4-7,9-10,14H2,1-3H3.
What are the key properties of [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine?
[4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine has a molecular weight of 252.36 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-1-[(1-methyltriazol-4-yl)methoxy]cyclohexyl]methanamine is sourced from PubChem (CID 107040797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).