About 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine
8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine (PubChem CID 10704105) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine |
| PubChem CID | 10704105 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine |
| SMILES | CN1CCN(C2=NC=CN3CCN=C23)CC1 |
| InChI | InChI=1S/C11H17N5/c1-14-6-8-16(9-7-14)11-10-12-2-4-15(10)5-3-13-11/h3,5H,2,4,6-9H2,1H3 |
| InChIKey | FDEOFZCUDZETGC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine?
The IUPAC name of 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine (CID 10704105) is 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine?
The canonical SMILES for 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine is CN1CCN(C2=NC=CN3CCN=C23)CC1.
What is the InChIKey of 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine?
The InChIKey is FDEOFZCUDZETGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c1-14-6-8-16(9-7-14)11-10-12-2-4-15(10)5-3-13-11/h3,5H,2,4,6-9H2,1H3.
What are the key properties of 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine?
8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine has a molecular weight of 219.29 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-methylpiperazin-1-yl)-2,3-dihydroimidazo[1,2-a]pyrazine is sourced from PubChem (CID 10704105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).