C14H21NO — CID 10704110
7-[methyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 10704110) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 7-[methyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 7-[methyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 10704110 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 7-[methyl(propyl)amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCCN(C)C1CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C14H21NO/c1-3-8-15(2)13-6-4-11-5-7-14(16)10-12(11)9-13/h5,7,10,13,16H,3-4,6,8-9H2,1-2H3 |
| InChIKey | UKKJJXAEHLPZSM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |