C14H21NO — CID 10704113
N,2,2,4,6,7-hexamethyl-3H-1-benzofuran-5-amine (PubChem CID 10704113) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N,2,2,4,6,7-hexamethyl-3H-1-benzofuran-5-amine.
| Compound Name | N,2,2,4,6,7-hexamethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10704113 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N,2,2,4,6,7-hexamethyl-3H-1-benzofuran-5-amine |
| SMILES | CNc1c(C)c(C)c2c(c1C)CC(C)(C)O2 |
| InChI | InChI=1S/C14H21NO/c1-8-9(2)13-11(7-14(4,5)16-13)10(3)12(8)15-6/h15H,7H2,1-6H3 |
| InChIKey | ZDLFHLWYWPGJOJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|