C9H9F2N5 — CID 107042078
3,5-difluoro-N-[(2-methyltetrazol-5-yl)methyl]aniline (PubChem CID 107042078) has the molecular formula C9H9F2N5 and a molecular weight of 225.20 g/mol. Its IUPAC name is 3,5-difluoro-N-[(2-methyltetrazol-5-yl)methyl]aniline.
| Compound Name | 3,5-difluoro-N-[(2-methyltetrazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 107042078 |
| Molecular Formula | C9H9F2N5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3,5-difluoro-N-[(2-methyltetrazol-5-yl)methyl]aniline |
| SMILES | Cn1nnc(CNc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C9H9F2N5/c1-16-14-9(13-15-16)5-12-8-3-6(10)2-7(11)4-8/h2-4,12H,5H2,1H3 |
| InChIKey | QAIFCCLNRSJMKJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |