C9H13N5S — CID 107042155
N-[(2-methyltetrazol-5-yl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 107042155) has the molecular formula C9H13N5S and a molecular weight of 223.31 g/mol. Its IUPAC name is N-[(2-methyltetrazol-5-yl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-[(2-methyltetrazol-5-yl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 107042155 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[(2-methyltetrazol-5-yl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | CC(NCc1nnn(C)n1)c1cccs1 |
| InChI | InChI=1S/C9H13N5S/c1-7(8-4-3-5-15-8)10-6-9-11-13-14(2)12-9/h3-5,7,10H,6H2,1-2H3 |
| InChIKey | RRPZKNMYXBTCLP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |