C12H17N5O — CID 107042297
2-(3-methylphenoxy)-N-[(2-methyltetrazol-5-yl)methyl]ethanamine (PubChem CID 107042297) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-[(2-methyltetrazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(3-methylphenoxy)-N-[(2-methyltetrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107042297 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-(3-methylphenoxy)-N-[(2-methyltetrazol-5-yl)methyl]ethanamine |
| SMILES | Cc1cccc(OCCNCc2nnn(C)n2)c1 |
| InChI | InChI=1S/C12H17N5O/c1-10-4-3-5-11(8-10)18-7-6-13-9-12-14-16-17(2)15-12/h3-5,8,13H,6-7,9H2,1-2H3 |
| InChIKey | WYRQEBXYJRXFMT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|