C11H13NO4 — CID 10704304
(4S,5S,6Z,9R,11S)-6-ethylidene-5,9-dihydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one (PubChem CID 10704304) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (4S,5S,6Z,9R,11S)-6-ethylidene-5,9-dihydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one.
| Compound Name | (4S,5S,6Z,9R,11S)-6-ethylidene-5,9-dihydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
|---|---|
| PubChem CID | 10704304 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (4S,5S,6Z,9R,11S)-6-ethylidene-5,9-dihydroxy-3-oxa-1-azatricyclo[5.3.1.04,11]undec-7-en-2-one |
| SMILES | C/C=C1/C2=C[C@@H](O)CN3C(=O)O[C@H]([C@H]1O)[C@H]23 |
| InChI | InChI=1S/C11H13NO4/c1-2-6-7-3-5(13)4-12-8(7)10(9(6)14)16-11(12)15/h2-3,5,8-10,13-14H,4H2,1H3/b6-2-/t5-,8+,9+,10+/m1/s1 |
| InChIKey | VVZZZOPRFXGZHF-RMFQZOGDSA-N |
| XLogP | -0.20 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |