C15H13NO — CID 10704313
(1S,10S,11S,16R)-14-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-15-one (PubChem CID 10704313) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is (1S,10S,11S,16R)-14-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-15-one.
| Compound Name | (1S,10S,11S,16R)-14-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-15-one |
|---|---|
| PubChem CID | 10704313 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (1S,10S,11S,16R)-14-azatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,12-pentaen-15-one |
| SMILES | O=C1NC=C[C@@H]2[C@@H]3C=Cc4ccccc4[C@@H]3[C@H]12 |
| InChI | InChI=1S/C15H13NO/c17-15-14-12(7-8-16-15)11-6-5-9-3-1-2-4-10(9)13(11)14/h1-8,11-14H,(H,16,17)/t11-,12+,13-,14+/m0/s1 |
| InChIKey | PSTKBLDSINWFOK-RFQIPJPRSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |