C12H16O4 — CID 10704347
(3aS,6aS)-3a-hydroxy-2,3-dimethoxy-6a-methyl-4-methylidene-5,6-dihydropentalen-1-one (PubChem CID 10704347) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3aS,6aS)-3a-hydroxy-2,3-dimethoxy-6a-methyl-4-methylidene-5,6-dihydropentalen-1-one.
| Compound Name | (3aS,6aS)-3a-hydroxy-2,3-dimethoxy-6a-methyl-4-methylidene-5,6-dihydropentalen-1-one |
|---|---|
| PubChem CID | 10704347 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3aS,6aS)-3a-hydroxy-2,3-dimethoxy-6a-methyl-4-methylidene-5,6-dihydropentalen-1-one |
| SMILES | C=C1CC[C@]2(C)C(=O)C(OC)=C(OC)[C@]12O |
| InChI | InChI=1S/C12H16O4/c1-7-5-6-11(2)9(13)8(15-3)10(16-4)12(7,11)14/h14H,1,5-6H2,2-4H3/t11-,12-/m1/s1 |
| InChIKey | ZMFAQCUHHOVMGP-VXGBXAGGSA-N |
| XLogP | 1.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|