About N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine
N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 107043617) has the molecular formula C10H22N6
and a molecular weight of 226.33 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 107043617 |
| Molecular Formula | C10H22N6 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | CN(CCNC(C)(C)C)Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H22N6/c1-10(2,3)11-6-7-15(4)8-9-12-14-16(5)13-9/h11H,6-8H2,1-5H3 |
| InChIKey | RNHQEOPATJGIFG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine (CID 107043617) is N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine is CN(CCNC(C)(C)C)Cc1nnn(C)n1.
What is the InChIKey of N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine?
The InChIKey is RNHQEOPATJGIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N6/c1-10(2,3)11-6-7-15(4)8-9-12-14-16(5)13-9/h11H,6-8H2,1-5H3.
What are the key properties of N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine?
N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine has a molecular weight of 226.33 g/mol, XLogP of 0.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-methyl-N'-[(2-methyltetrazol-5-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 107043617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).