C11H7F2N5O2 — CID 107043757
5,7-difluoro-1-[(2-methyltetrazol-5-yl)methyl]indole-2,3-dione (PubChem CID 107043757) has the molecular formula C11H7F2N5O2 and a molecular weight of 279.21 g/mol. Its IUPAC name is 5,7-difluoro-1-[(2-methyltetrazol-5-yl)methyl]indole-2,3-dione.
| Compound Name | 5,7-difluoro-1-[(2-methyltetrazol-5-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 107043757 |
| Molecular Formula | C11H7F2N5O2 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5,7-difluoro-1-[(2-methyltetrazol-5-yl)methyl]indole-2,3-dione |
| SMILES | Cn1nnc(CN2C(=O)C(=O)c3cc(F)cc(F)c32)n1 |
| InChI | InChI=1S/C11H7F2N5O2/c1-17-15-8(14-16-17)4-18-9-6(10(19)11(18)20)2-5(12)3-7(9)13/h2-3H,4H2,1H3 |
| InChIKey | HGUBQFMBJVOCSO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|