C14H18N4O2 — CID 107044834
3-[4-methyl-N-[(1-methyltriazol-4-yl)methyl]anilino]propanoic acid (PubChem CID 107044834) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[4-methyl-N-[(1-methyltriazol-4-yl)methyl]anilino]propanoic acid.
| Compound Name | 3-[4-methyl-N-[(1-methyltriazol-4-yl)methyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 107044834 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-[4-methyl-N-[(1-methyltriazol-4-yl)methyl]anilino]propanoic acid |
| SMILES | Cc1ccc(N(CCC(=O)O)Cc2cn(C)nn2)cc1 |
| InChI | InChI=1S/C14H18N4O2/c1-11-3-5-13(6-4-11)18(8-7-14(19)20)10-12-9-17(2)16-15-12/h3-6,9H,7-8,10H2,1-2H3,(H,19,20) |
| InChIKey | HPEBAXOSKMYJRI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|