2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid

C9H16N4O2 — CID 107045183

IUPAC2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid
SMILESCC(C)C(C)(Cc1nnn(C)n1)C(=O)O
InChIInChI=1S/C9H16N4O2/c1-6(2)9(3,8(14)15)5-7-10-12-13(4)11-7/h6H,5H2,1-4H3,(H,14,15)
InChIKeyKNKYFNIBXICIHA-UHFFFAOYSA-N
MW212.25 g/mol
LogP0.50
Rot. Bonds4

About 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid

2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid (PubChem CID 107045183) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid.

Molecular Properties

Compound Name2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid
PubChem CID107045183
Molecular FormulaC9H16N4O2
Molecular Weight212.25 g/mol
Exact Mass212.13
IUPAC Name2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid
SMILESCC(C)C(C)(Cc1nnn(C)n1)C(=O)O
InChIInChI=1S/C9H16N4O2/c1-6(2)9(3,8(14)15)5-7-10-12-13(4)11-7/h6H,5H2,1-4H3,(H,14,15)
InChIKeyKNKYFNIBXICIHA-UHFFFAOYSA-N
XLogP0.50
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid?
The IUPAC name of 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid (CID 107045183) is 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid.
What is the SMILES notation for 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid?
The canonical SMILES for 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid is CC(C)C(C)(Cc1nnn(C)n1)C(=O)O.
What is the InChIKey of 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid?
The InChIKey is KNKYFNIBXICIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2/c1-6(2)9(3,8(14)15)5-7-10-12-13(4)11-7/h6H,5H2,1-4H3,(H,14,15).
What are the key properties of 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid?
2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid has a molecular weight of 212.25 g/mol, XLogP of 0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2-[(2-methyltetrazol-5-yl)methyl]butanoic acid is sourced from PubChem (CID 107045183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).